About (5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene
(5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene (PubChem CID 89391117) has the molecular formula C6H5ClF2
and a molecular weight of 150.56 g/mol. Its IUPAC name is (5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | (5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene |
| PubChem CID | 89391117 |
| Molecular Formula | C6H5ClF2 |
| Molecular Weight | 150.56 g/mol |
| Exact Mass | 150.00 |
| IUPAC Name | (5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene |
| SMILES | FC1=C[C@H](Cl)CC(F)=C1 |
| InChI | InChI=1S/C6H5ClF2/c7-4-1-5(8)3-6(9)2-4/h1,3-4H,2H2/t4-/m0/s1 |
| InChIKey | JURBTQUPPLNDOU-BYPYZUCNSA-N |
| XLogP | 2.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene?
The IUPAC name of (5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene (CID 89391117) is (5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene.
What is the SMILES notation for (5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene?
The canonical SMILES for (5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene is FC1=C[C@H](Cl)CC(F)=C1.
What is the InChIKey of (5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene?
The InChIKey is JURBTQUPPLNDOU-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H5ClF2/c7-4-1-5(8)3-6(9)2-4/h1,3-4H,2H2/t4-/m0/s1.
What are the key properties of (5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene?
(5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene has a molecular weight of 150.56 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-chloro-1,3-difluorocyclohexa-1,3-diene is sourced from PubChem (CID 89391117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).