2-fluorocyclohexa-2,4-diene-1-carboxylic acid

C7H7FO2 — CID 89391246

IUPAC2-fluorocyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1CC=CC=C1F
InChIInChI=1S/C7H7FO2/c8-6-4-2-1-3-5(6)7(9)10/h1-2,4-5H,3H2,(H,9,10)
InChIKeyUHWNDKWXXGEIFZ-UHFFFAOYSA-N
MW142.13 g/mol
LogP1.50
Rot. Bonds1

About 2-fluorocyclohexa-2,4-diene-1-carboxylic acid

2-fluorocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 89391246) has the molecular formula C7H7FO2 and a molecular weight of 142.13 g/mol. Its IUPAC name is 2-fluorocyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name2-fluorocyclohexa-2,4-diene-1-carboxylic acid
PubChem CID89391246
Molecular FormulaC7H7FO2
Molecular Weight142.13 g/mol
Exact Mass142.04
IUPAC Name2-fluorocyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1CC=CC=C1F
InChIInChI=1S/C7H7FO2/c8-6-4-2-1-3-5(6)7(9)10/h1-2,4-5H,3H2,(H,9,10)
InChIKeyUHWNDKWXXGEIFZ-UHFFFAOYSA-N
XLogP1.50
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.13
LogP ≤ 51.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-fluorocyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluorocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 2-fluorocyclohexa-2,4-diene-1-carboxylic acid (CID 89391246) is 2-fluorocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 2-fluorocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 2-fluorocyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1CC=CC=C1F.
What is the InChIKey of 2-fluorocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is UHWNDKWXXGEIFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FO2/c8-6-4-2-1-3-5(6)7(9)10/h1-2,4-5H,3H2,(H,9,10).
What are the key properties of 2-fluorocyclohexa-2,4-diene-1-carboxylic acid?
2-fluorocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 142.13 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 89391246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).