C7H9ClS — CID 89391295
(1E,3E,5Z)-1-chlorohepta-1,3,5-triene-4-thiol (PubChem CID 89391295) has the molecular formula C7H9ClS and a molecular weight of 160.67 g/mol. Its IUPAC name is (1E,3E,5Z)-1-chlorohepta-1,3,5-triene-4-thiol.
| Compound Name | (1E,3E,5Z)-1-chlorohepta-1,3,5-triene-4-thiol |
|---|---|
| PubChem CID | 89391295 |
| Molecular Formula | C7H9ClS |
| Molecular Weight | 160.67 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | (1E,3E,5Z)-1-chlorohepta-1,3,5-triene-4-thiol |
| SMILES | C/C=C\C(S)=C/C=C/Cl |
| InChI | InChI=1S/C7H9ClS/c1-2-4-7(9)5-3-6-8/h2-6,9H,1H3/b4-2-,6-3+,7-5+ |
| InChIKey | CCXRUQGEALNXLW-QFDREYBASA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.67 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|