About (5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane
(5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane (PubChem CID 89391492) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is (5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | (5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane |
| PubChem CID | 89391492 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane |
| SMILES | CCN1CCN2CC[C@@H]1C2 |
| InChI | InChI=1S/C8H16N2/c1-2-10-6-5-9-4-3-8(10)7-9/h8H,2-7H2,1H3/t8-/m1/s1 |
| InChIKey | AEZUZGIKJUFVQJ-MRVPVSSYSA-N |
| XLogP | 0.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane?
The IUPAC name of (5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane (CID 89391492) is (5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane.
What is the SMILES notation for (5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane?
The canonical SMILES for (5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane is CCN1CCN2CC[C@@H]1C2.
What is the InChIKey of (5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane?
The InChIKey is AEZUZGIKJUFVQJ-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H16N2/c1-2-10-6-5-9-4-3-8(10)7-9/h8H,2-7H2,1H3/t8-/m1/s1.
What are the key properties of (5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane?
(5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane has a molecular weight of 140.23 g/mol, XLogP of 0.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-4-ethyl-1,4-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 89391492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).