C21H26BF3N2O5 — CID 89391619
N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-4-yl]-1-[(2,2,2-trifluoroacetyl)amino]cyclopropane-1-carboxamide (PubChem CID 89391619) has the molecular formula C21H26BF3N2O5 and a molecular weight of 454.25 g/mol. Its IUPAC name is N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-4-yl]-1-[(2,2,2-trifluoroacetyl)amino]cyclopropane-1-carboxamide.
| Compound Name | N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-4-yl]-1-[(2,2,2-trifluoroacetyl)amino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 89391619 |
| Molecular Formula | C21H26BF3N2O5 |
| Molecular Weight | 454.25 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-4-yl]-1-[(2,2,2-trifluoroacetyl)amino]cyclopropane-1-carboxamide |
| SMILES | CC1(C)OB(c2ccc3c(c2)OCCC3NC(=O)C2(NC(=O)C(F)(F)F)CC2)OC1(C)C |
| InChI | InChI=1S/C21H26BF3N2O5/c1-18(2)19(3,4)32-22(31-18)12-5-6-13-14(7-10-30-15(13)11-12)26-16(28)20(8-9-20)27-17(29)21(23,24)25/h5-6,11,14H,7-10H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | OXYDYIWUDVTGBB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|