C17H18IN3O — CID 89391764
5-[3-[3-(iodomethyl)phenyl]phenyl]-2,5-dimethyl-1,2,4-oxadiazol-3-amine (PubChem CID 89391764) has the molecular formula C17H18IN3O and a molecular weight of 407.26 g/mol. Its IUPAC name is 5-[3-[3-(iodomethyl)phenyl]phenyl]-2,5-dimethyl-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-[3-[3-(iodomethyl)phenyl]phenyl]-2,5-dimethyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 89391764 |
| Molecular Formula | C17H18IN3O |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 5-[3-[3-(iodomethyl)phenyl]phenyl]-2,5-dimethyl-1,2,4-oxadiazol-3-amine |
| SMILES | CN1OC(C)(c2cccc(-c3cccc(CI)c3)c2)N=C1N |
| InChI | InChI=1S/C17H18IN3O/c1-17(20-16(19)21(2)22-17)15-8-4-7-14(10-15)13-6-3-5-12(9-13)11-18/h3-10H,11H2,1-2H3,(H2,19,20) |
| InChIKey | PBUYJIRORQZTDO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|