About 6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine
6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine (PubChem CID 89392047) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine.
Molecular Properties
| Compound Name | 6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine |
| PubChem CID | 89392047 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine |
| SMILES | Cc1cnc2c(n1)C=CNN2 |
| InChI | InChI=1S/C7H8N4/c1-5-4-8-7-6(10-5)2-3-9-11-7/h2-4,9H,1H3,(H,8,11) |
| InChIKey | BARFPOBXEBZXQA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine?
The IUPAC name of 6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine (CID 89392047) is 6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine.
What is the SMILES notation for 6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine?
The canonical SMILES for 6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine is Cc1cnc2c(n1)C=CNN2.
What is the InChIKey of 6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine?
The InChIKey is BARFPOBXEBZXQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-5-4-8-7-6(10-5)2-3-9-11-7/h2-4,9H,1H3,(H,8,11).
What are the key properties of 6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine?
6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine has a molecular weight of 148.17 g/mol, XLogP of 0.69, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,2-dihydropyrazino[2,3-c]pyridazine is sourced from PubChem (CID 89392047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).