C33H47NO — CID 89392085
1-[(4aS)-7-[(1Z)-buta-1,3-dienyl]-5-[(1E,3S)-3,4-dimethyl-2-[(2Z)-penta-2,4-dienoxy]penta-1,4-dienyl]-6,8-dimethyl-2,3,4,4a,7,8-hexahydronaphthalen-2-yl]piperidine (PubChem CID 89392085) has the molecular formula C33H47NO and a molecular weight of 473.75 g/mol. Its IUPAC name is 1-[(4aS)-7-[(1Z)-buta-1,3-dienyl]-5-[(1E,3S)-3,4-dimethyl-2-[(2Z)-penta-2,4-dienoxy]penta-1,4-dienyl]-6,8-dimethyl-2,3,4,4a,7,8-hexahydronaphthalen-2-yl]piperidine.
| Compound Name | 1-[(4aS)-7-[(1Z)-buta-1,3-dienyl]-5-[(1E,3S)-3,4-dimethyl-2-[(2Z)-penta-2,4-dienoxy]penta-1,4-dienyl]-6,8-dimethyl-2,3,4,4a,7,8-hexahydronaphthalen-2-yl]piperidine |
|---|---|
| PubChem CID | 89392085 |
| Molecular Formula | C33H47NO |
| Molecular Weight | 473.75 g/mol |
| Exact Mass | 473.37 |
| IUPAC Name | 1-[(4aS)-7-[(1Z)-buta-1,3-dienyl]-5-[(1E,3S)-3,4-dimethyl-2-[(2Z)-penta-2,4-dienoxy]penta-1,4-dienyl]-6,8-dimethyl-2,3,4,4a,7,8-hexahydronaphthalen-2-yl]piperidine |
| SMILES | C=C/C=C\CO/C(=C/C1=C(C)C(/C=C\C=C)C(C)C2=CC(N3CCCCC3)CC[C@@H]21)[C@@H](C)C(=C)C |
| InChI | InChI=1S/C33H47NO/c1-8-10-15-21-35-33(25(5)24(3)4)23-32-27(7)29(16-11-9-2)26(6)31-22-28(17-18-30(31)32)34-19-13-12-14-20-34/h8-11,15-16,22-23,25-26,28-30H,1-3,12-14,17-21H2,4-7H3/b15-10-,16-11-,33-23+/t25-,26?,28?,29?,30-/m0/s1 |
| InChIKey | KJDAQFWVZUJLIP-IKXHIJGESA-N |
| XLogP | 8.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.75 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|