C29H44S — CID 89392154
(3S)-5-but-3-enyl-2-[[(5Z,6E)-3-[(Z)-but-1-enyl]-6-ethylidene-2,4-dimethyl-5-(2-methylpropylidene)cyclohexen-1-yl]methyl]-3,4-dimethyl-2,3-dihydrothiophene (PubChem CID 89392154) has the molecular formula C29H44S and a molecular weight of 424.74 g/mol. Its IUPAC name is (3S)-5-but-3-enyl-2-[[(5Z,6E)-3-[(Z)-but-1-enyl]-6-ethylidene-2,4-dimethyl-5-(2-methylpropylidene)cyclohexen-1-yl]methyl]-3,4-dimethyl-2,3-dihydrothiophene.
| Compound Name | (3S)-5-but-3-enyl-2-[[(5Z,6E)-3-[(Z)-but-1-enyl]-6-ethylidene-2,4-dimethyl-5-(2-methylpropylidene)cyclohexen-1-yl]methyl]-3,4-dimethyl-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 89392154 |
| Molecular Formula | C29H44S |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | (3S)-5-but-3-enyl-2-[[(5Z,6E)-3-[(Z)-but-1-enyl]-6-ethylidene-2,4-dimethyl-5-(2-methylpropylidene)cyclohexen-1-yl]methyl]-3,4-dimethyl-2,3-dihydrothiophene |
| SMILES | C=CCCC1=C(C)[C@H](C)C(CC2=C(C)C(/C=C\CC)C(C)C(=C/C(C)C)/C2=C\C)S1 |
| InChI | InChI=1S/C29H44S/c1-10-13-15-25-22(8)26(17-19(4)5)24(12-3)27(23(25)9)18-29-21(7)20(6)28(30-29)16-14-11-2/h11-13,15,17,19,21-22,25,29H,2,10,14,16,18H2,1,3-9H3/b15-13-,24-12+,26-17-/t21-,22?,25?,29?/m0/s1 |
| InChIKey | YRJKOOYWPDVYFT-UIWSTLPBSA-N |
| XLogP | 9.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|