C31H35N2O4PS — CID 89392276
2-[(E)-(1-benzylquinolin-4-ylidene)methyl]-3-(3-diethoxyphosphorylpropyl)-1,3-benzothiazol-2-ol (PubChem CID 89392276) has the molecular formula C31H35N2O4PS and a molecular weight of 562.67 g/mol. Its IUPAC name is 2-[(E)-(1-benzylquinolin-4-ylidene)methyl]-3-(3-diethoxyphosphorylpropyl)-1,3-benzothiazol-2-ol.
| Compound Name | 2-[(E)-(1-benzylquinolin-4-ylidene)methyl]-3-(3-diethoxyphosphorylpropyl)-1,3-benzothiazol-2-ol |
|---|---|
| PubChem CID | 89392276 |
| Molecular Formula | C31H35N2O4PS |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 2-[(E)-(1-benzylquinolin-4-ylidene)methyl]-3-(3-diethoxyphosphorylpropyl)-1,3-benzothiazol-2-ol |
| SMILES | CCOP(=O)(CCCN1c2ccccc2SC1(O)/C=C1\C=CN(Cc2ccccc2)c2ccccc21)OCC |
| InChI | InChI=1S/C31H35N2O4PS/c1-3-36-38(35,37-4-2)22-12-20-33-29-17-10-11-18-30(29)39-31(33,34)23-26-19-21-32(24-25-13-6-5-7-14-25)28-16-9-8-15-27(26)28/h5-11,13-19,21,23,34H,3-4,12,20,22,24H2,1-2H3/b26-23+ |
| InChIKey | VWSUVONZOVHIKD-WNAAXNPUSA-N |
| XLogP | 7.52 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|