About (NE)-N-butan-2-ylidenehydroxylamine;methoxymethane
(NE)-N-butan-2-ylidenehydroxylamine;methoxymethane (PubChem CID 89392475) has the molecular formula C6H15NO2
and a molecular weight of 133.19 g/mol. Its IUPAC name is (NE)-N-butan-2-ylidenehydroxylamine;methoxymethane.
Molecular Properties
| Compound Name | (NE)-N-butan-2-ylidenehydroxylamine;methoxymethane |
| PubChem CID | 89392475 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | (NE)-N-butan-2-ylidenehydroxylamine;methoxymethane |
| SMILES | CC/C(C)=N/O.COC |
| InChI | InChI=1S/C4H9NO.C2H6O/c1-3-4(2)5-6;1-3-2/h6H,3H2,1-2H3;1-2H3/b5-4+; |
| InChIKey | JHJYRUNYSFEPRO-FXRZFVDSSA-N |
| XLogP | 1.51 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-butan-2-ylidenehydroxylamine;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-butan-2-ylidenehydroxylamine;methoxymethane?
The IUPAC name of (NE)-N-butan-2-ylidenehydroxylamine;methoxymethane (CID 89392475) is (NE)-N-butan-2-ylidenehydroxylamine;methoxymethane.
What is the SMILES notation for (NE)-N-butan-2-ylidenehydroxylamine;methoxymethane?
The canonical SMILES for (NE)-N-butan-2-ylidenehydroxylamine;methoxymethane is CC/C(C)=N/O.COC.
What is the InChIKey of (NE)-N-butan-2-ylidenehydroxylamine;methoxymethane?
The InChIKey is JHJYRUNYSFEPRO-FXRZFVDSSA-N. The full InChI is InChI=1S/C4H9NO.C2H6O/c1-3-4(2)5-6;1-3-2/h6H,3H2,1-2H3;1-2H3/b5-4+;.
What are the key properties of (NE)-N-butan-2-ylidenehydroxylamine;methoxymethane?
(NE)-N-butan-2-ylidenehydroxylamine;methoxymethane has a molecular weight of 133.19 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-butan-2-ylidenehydroxylamine;methoxymethane is sourced from PubChem (CID 89392475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).