C15H22BrF2O3P — CID 89392682
(3Z,5E)-5-[(E)-2-bromo-2-di(propan-2-yloxy)phosphorylethenyl]-2,7-difluorohepta-1,3,5-triene (PubChem CID 89392682) has the molecular formula C15H22BrF2O3P and a molecular weight of 399.21 g/mol. Its IUPAC name is (3Z,5E)-5-[(E)-2-bromo-2-di(propan-2-yloxy)phosphorylethenyl]-2,7-difluorohepta-1,3,5-triene.
| Compound Name | (3Z,5E)-5-[(E)-2-bromo-2-di(propan-2-yloxy)phosphorylethenyl]-2,7-difluorohepta-1,3,5-triene |
|---|---|
| PubChem CID | 89392682 |
| Molecular Formula | C15H22BrF2O3P |
| Molecular Weight | 399.21 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | (3Z,5E)-5-[(E)-2-bromo-2-di(propan-2-yloxy)phosphorylethenyl]-2,7-difluorohepta-1,3,5-triene |
| SMILES | C=C(F)/C=C\C(=C/CF)\C=C(\Br)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C15H22BrF2O3P/c1-11(2)20-22(19,21-12(3)4)15(16)10-14(8-9-17)7-6-13(5)18/h6-8,10-12H,5,9H2,1-4H3/b7-6-,14-8+,15-10- |
| InChIKey | VXXHWFYAIDRNHS-RIZBLKGRSA-N |
| XLogP | 6.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.21 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|