About (3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne
(3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne (PubChem CID 89392703) has the molecular formula C8H7F
and a molecular weight of 122.14 g/mol. Its IUPAC name is (3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne.
Molecular Properties
| Compound Name | (3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne |
| PubChem CID | 89392703 |
| Molecular Formula | C8H7F |
| Molecular Weight | 122.14 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | (3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne |
| SMILES | C#C/C=C\C(F)=C/C=C |
| InChI | InChI=1S/C8H7F/c1-3-5-7-8(9)6-4-2/h1,4-7H,2H2/b7-5-,8-6+ |
| InChIKey | KUGZWHCPHDSOAN-CGXWXWIYSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.14 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne?
The IUPAC name of (3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne (CID 89392703) is (3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne.
What is the SMILES notation for (3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne?
The canonical SMILES for (3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne is C#C/C=C\C(F)=C/C=C.
What is the InChIKey of (3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne?
The InChIKey is KUGZWHCPHDSOAN-CGXWXWIYSA-N. The full InChI is InChI=1S/C8H7F/c1-3-5-7-8(9)6-4-2/h1,4-7H,2H2/b7-5-,8-6+.
What are the key properties of (3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne?
(3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne has a molecular weight of 122.14 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-4-fluoroocta-1,3,5-trien-7-yne is sourced from PubChem (CID 89392703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).