C18H22N2O5S — CID 8939302
2-[(3R)-1,1-dioxothiolan-3-yl]-N'-[2-(6-ethyl-1-benzofuran-3-yl)acetyl]acetohydrazide (PubChem CID 8939302) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-N'-[2-(6-ethyl-1-benzofuran-3-yl)acetyl]acetohydrazide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N'-[2-(6-ethyl-1-benzofuran-3-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 8939302 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N'-[2-(6-ethyl-1-benzofuran-3-yl)acetyl]acetohydrazide |
| SMILES | CCc1ccc2c(CC(=O)NNC(=O)C[C@@H]3CCS(=O)(=O)C3)coc2c1 |
| InChI | InChI=1S/C18H22N2O5S/c1-2-12-3-4-15-14(10-25-16(15)7-12)9-18(22)20-19-17(21)8-13-5-6-26(23,24)11-13/h3-4,7,10,13H,2,5-6,8-9,11H2,1H3,(H,19,21)(H,20,22)/t13-/m0/s1 |
| InChIKey | SRCDTIXGKPIWOZ-ZDUSSCGKSA-N |
| XLogP | 1.51 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|