C31H31F3N8O3 — CID 89393061
benzyl (3R)-3-[4-amino-5-[4-[[(2E,4Z)-5-amino-3-(trifluoromethyl)penta-2,4-dienyl]carbamoyl]phenyl]imidazo[5,1-f][1,2,4]triazin-7-yl]piperidine-1-carboxylate (PubChem CID 89393061) has the molecular formula C31H31F3N8O3 and a molecular weight of 620.64 g/mol. Its IUPAC name is benzyl (3R)-3-[4-amino-5-[4-[[(2E,4Z)-5-amino-3-(trifluoromethyl)penta-2,4-dienyl]carbamoyl]phenyl]imidazo[5,1-f][1,2,4]triazin-7-yl]piperidine-1-carboxylate.
| Compound Name | benzyl (3R)-3-[4-amino-5-[4-[[(2E,4Z)-5-amino-3-(trifluoromethyl)penta-2,4-dienyl]carbamoyl]phenyl]imidazo[5,1-f][1,2,4]triazin-7-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89393061 |
| Molecular Formula | C31H31F3N8O3 |
| Molecular Weight | 620.64 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | benzyl (3R)-3-[4-amino-5-[4-[[(2E,4Z)-5-amino-3-(trifluoromethyl)penta-2,4-dienyl]carbamoyl]phenyl]imidazo[5,1-f][1,2,4]triazin-7-yl]piperidine-1-carboxylate |
| SMILES | N/C=C\C(=C/CNC(=O)c1ccc(-c2nc([C@@H]3CCCN(C(=O)OCc4ccccc4)C3)n3ncnc(N)c23)cc1)C(F)(F)F |
| InChI | InChI=1S/C31H31F3N8O3/c32-31(33,34)24(12-14-35)13-15-37-29(43)22-10-8-21(9-11-22)25-26-27(36)38-19-39-42(26)28(40-25)23-7-4-16-41(17-23)30(44)45-18-20-5-2-1-3-6-20/h1-3,5-6,8-14,19,23H,4,7,15-18,35H2,(H,37,43)(H2,36,38,39)/b14-12-,24-13+/t23-/m1/s1 |
| InChIKey | TWZINYCPRUDHFB-YQSVUCEVSA-N |
| XLogP | 4.58 |
| TPSA | 153.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|