C8H11N5 — CID 89393083
5-ethyl-7-methylimidazo[5,1-f][1,2,4]triazin-4-amine (PubChem CID 89393083) has the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. Its IUPAC name is 5-ethyl-7-methylimidazo[5,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-ethyl-7-methylimidazo[5,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 89393083 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 5-ethyl-7-methylimidazo[5,1-f][1,2,4]triazin-4-amine |
| SMILES | CCc1nc(C)n2ncnc(N)c12 |
| InChI | InChI=1S/C8H11N5/c1-3-6-7-8(9)10-4-11-13(7)5(2)12-6/h4H,3H2,1-2H3,(H2,9,10,11) |
| InChIKey | LEUHCZBHGNAFRD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |