C12H22O2 — CID 89393236
(4E,6Z)-3,7-dimethyldeca-4,6-diene-2,4-diol (PubChem CID 89393236) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (4E,6Z)-3,7-dimethyldeca-4,6-diene-2,4-diol.
| Compound Name | (4E,6Z)-3,7-dimethyldeca-4,6-diene-2,4-diol |
|---|---|
| PubChem CID | 89393236 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (4E,6Z)-3,7-dimethyldeca-4,6-diene-2,4-diol |
| SMILES | CCC/C(C)=C\C=C(\O)C(C)C(C)O |
| InChI | InChI=1S/C12H22O2/c1-5-6-9(2)7-8-12(14)10(3)11(4)13/h7-8,10-11,13-14H,5-6H2,1-4H3/b9-7-,12-8+ |
| InChIKey | XUAXABDYAZMGRE-ZUQSVMQASA-N |
| XLogP | 3.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|