C10H18OS — CID 89393265
(1R,7aS)-3-ethyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophen-1-ol (PubChem CID 89393265) has the molecular formula C10H18OS and a molecular weight of 186.32 g/mol. Its IUPAC name is (1R,7aS)-3-ethyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophen-1-ol.
| Compound Name | (1R,7aS)-3-ethyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophen-1-ol |
|---|---|
| PubChem CID | 89393265 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (1R,7aS)-3-ethyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophen-1-ol |
| SMILES | CCC1S[C@@H](O)[C@H]2CCCCC12 |
| InChI | InChI=1S/C10H18OS/c1-2-9-7-5-3-4-6-8(7)10(11)12-9/h7-11H,2-6H2,1H3/t7?,8-,9?,10+/m0/s1 |
| InChIKey | XGRJHHKKKFDBAH-RVXWLBMTSA-N |
| XLogP | 2.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |