About 1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol
1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol (PubChem CID 89393276) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol |
| PubChem CID | 89393276 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol |
| SMILES | CCC1=CC(C(C)O)=CCC1 |
| InChI | InChI=1S/C10H16O/c1-3-9-5-4-6-10(7-9)8(2)11/h6-8,11H,3-5H2,1-2H3 |
| InChIKey | MPYMOXLWFCNQBJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol?
The IUPAC name of 1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol (CID 89393276) is 1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol.
What is the SMILES notation for 1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol?
The canonical SMILES for 1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol is CCC1=CC(C(C)O)=CCC1.
What is the InChIKey of 1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol?
The InChIKey is MPYMOXLWFCNQBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-3-9-5-4-6-10(7-9)8(2)11/h6-8,11H,3-5H2,1-2H3.
What are the key properties of 1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol?
1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol has a molecular weight of 152.24 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethylcyclohexa-1,5-dien-1-yl)ethanol is sourced from PubChem (CID 89393276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).