About 5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole
5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole (PubChem CID 89393428) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole |
| PubChem CID | 89393428 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole |
| SMILES | CCC1CC(C(C)C)=NO1 |
| InChI | InChI=1S/C8H15NO/c1-4-7-5-8(6(2)3)9-10-7/h6-7H,4-5H2,1-3H3 |
| InChIKey | PNALBHZCZZJALJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole?
The IUPAC name of 5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole (CID 89393428) is 5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole is CCC1CC(C(C)C)=NO1.
What is the InChIKey of 5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole?
The InChIKey is PNALBHZCZZJALJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-4-7-5-8(6(2)3)9-10-7/h6-7H,4-5H2,1-3H3.
What are the key properties of 5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole?
5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole has a molecular weight of 141.21 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3-propan-2-yl-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 89393428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).