About 2-methyl-3H-furo[2,3-e]benzimidazole
2-methyl-3H-furo[2,3-e]benzimidazole (PubChem CID 89393490) has the molecular formula C10H8N2O
and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-methyl-3H-furo[2,3-e]benzimidazole.
Molecular Properties
| Compound Name | 2-methyl-3H-furo[2,3-e]benzimidazole |
| PubChem CID | 89393490 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 2-methyl-3H-furo[2,3-e]benzimidazole |
| SMILES | Cc1nc2c(ccc3ccoc32)[nH]1 |
| InChI | InChI=1S/C10H8N2O/c1-6-11-8-3-2-7-4-5-13-10(7)9(8)12-6/h2-5H,1H3,(H,11,12) |
| InChIKey | AKCDNRUXWFVMSE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3H-furo[2,3-e]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3H-furo[2,3-e]benzimidazole?
The IUPAC name of 2-methyl-3H-furo[2,3-e]benzimidazole (CID 89393490) is 2-methyl-3H-furo[2,3-e]benzimidazole.
What is the SMILES notation for 2-methyl-3H-furo[2,3-e]benzimidazole?
The canonical SMILES for 2-methyl-3H-furo[2,3-e]benzimidazole is Cc1nc2c(ccc3ccoc32)[nH]1.
What is the InChIKey of 2-methyl-3H-furo[2,3-e]benzimidazole?
The InChIKey is AKCDNRUXWFVMSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O/c1-6-11-8-3-2-7-4-5-13-10(7)9(8)12-6/h2-5H,1H3,(H,11,12).
What are the key properties of 2-methyl-3H-furo[2,3-e]benzimidazole?
2-methyl-3H-furo[2,3-e]benzimidazole has a molecular weight of 172.19 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3H-furo[2,3-e]benzimidazole is sourced from PubChem (CID 89393490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).