About 4-ethenyl-1,2-dimethyl-2H-pyridine
4-ethenyl-1,2-dimethyl-2H-pyridine (PubChem CID 89393501) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 4-ethenyl-1,2-dimethyl-2H-pyridine.
Molecular Properties
| Compound Name | 4-ethenyl-1,2-dimethyl-2H-pyridine |
| PubChem CID | 89393501 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 4-ethenyl-1,2-dimethyl-2H-pyridine |
| SMILES | C=CC1=CC(C)N(C)C=C1 |
| InChI | InChI=1S/C9H13N/c1-4-9-5-6-10(3)8(2)7-9/h4-8H,1H2,2-3H3 |
| InChIKey | TXXGDTJLVHRWKI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenyl-1,2-dimethyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-1,2-dimethyl-2H-pyridine?
The IUPAC name of 4-ethenyl-1,2-dimethyl-2H-pyridine (CID 89393501) is 4-ethenyl-1,2-dimethyl-2H-pyridine.
What is the SMILES notation for 4-ethenyl-1,2-dimethyl-2H-pyridine?
The canonical SMILES for 4-ethenyl-1,2-dimethyl-2H-pyridine is C=CC1=CC(C)N(C)C=C1.
What is the InChIKey of 4-ethenyl-1,2-dimethyl-2H-pyridine?
The InChIKey is TXXGDTJLVHRWKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-4-9-5-6-10(3)8(2)7-9/h4-8H,1H2,2-3H3.
What are the key properties of 4-ethenyl-1,2-dimethyl-2H-pyridine?
4-ethenyl-1,2-dimethyl-2H-pyridine has a molecular weight of 135.21 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-1,2-dimethyl-2H-pyridine is sourced from PubChem (CID 89393501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).