About 2-methanimidoyl-N,3-dimethylbut-2-enamide
2-methanimidoyl-N,3-dimethylbut-2-enamide (PubChem CID 89393510) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-methanimidoyl-N,3-dimethylbut-2-enamide.
Molecular Properties
| Compound Name | 2-methanimidoyl-N,3-dimethylbut-2-enamide |
| PubChem CID | 89393510 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2-methanimidoyl-N,3-dimethylbut-2-enamide |
| SMILES | [H]/N=C/C(C(=O)NC)=C(C)C |
| InChI | InChI=1S/C7H12N2O/c1-5(2)6(4-8)7(10)9-3/h4,8H,1-3H3,(H,9,10)/b8-4+ |
| InChIKey | YISYTTYGNIQPDQ-XBXARRHUSA-N |
| XLogP | 0.72 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methanimidoyl-N,3-dimethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanimidoyl-N,3-dimethylbut-2-enamide?
The IUPAC name of 2-methanimidoyl-N,3-dimethylbut-2-enamide (CID 89393510) is 2-methanimidoyl-N,3-dimethylbut-2-enamide.
What is the SMILES notation for 2-methanimidoyl-N,3-dimethylbut-2-enamide?
The canonical SMILES for 2-methanimidoyl-N,3-dimethylbut-2-enamide is [H]/N=C/C(C(=O)NC)=C(C)C.
What is the InChIKey of 2-methanimidoyl-N,3-dimethylbut-2-enamide?
The InChIKey is YISYTTYGNIQPDQ-XBXARRHUSA-N. The full InChI is InChI=1S/C7H12N2O/c1-5(2)6(4-8)7(10)9-3/h4,8H,1-3H3,(H,9,10)/b8-4+.
What are the key properties of 2-methanimidoyl-N,3-dimethylbut-2-enamide?
2-methanimidoyl-N,3-dimethylbut-2-enamide has a molecular weight of 140.19 g/mol, XLogP of 0.72, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanimidoyl-N,3-dimethylbut-2-enamide is sourced from PubChem (CID 89393510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).