About (1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid
(1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 89393650) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is (1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | (1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 89393650 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | (1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | N[C@@H]1C(O)=CC=C[C@H]1C(=O)O |
| InChI | InChI=1S/C7H9NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-4,6,9H,8H2,(H,10,11)/t4-,6+/m1/s1 |
| InChIKey | XBZSAEYMLVBNSJ-XINAWCOVSA-N |
| XLogP | 0.03 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of (1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid (CID 89393650) is (1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for (1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for (1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid is N[C@@H]1C(O)=CC=C[C@H]1C(=O)O.
What is the InChIKey of (1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is XBZSAEYMLVBNSJ-XINAWCOVSA-N. The full InChI is InChI=1S/C7H9NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-4,6,9H,8H2,(H,10,11)/t4-,6+/m1/s1.
What are the key properties of (1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
(1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 155.15 g/mol, XLogP of 0.03, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6S)-6-amino-5-hydroxycyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 89393650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).