C17H28F4O5S — CID 89393659
1,1,2,2-tetrafluoro-6-(1,2,3,4,5-pentamethylcyclopentanecarbonyl)oxyhexane-1-sulfonic acid (PubChem CID 89393659) has the molecular formula C17H28F4O5S and a molecular weight of 420.47 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-(1,2,3,4,5-pentamethylcyclopentanecarbonyl)oxyhexane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-6-(1,2,3,4,5-pentamethylcyclopentanecarbonyl)oxyhexane-1-sulfonic acid |
|---|---|
| PubChem CID | 89393659 |
| Molecular Formula | C17H28F4O5S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-(1,2,3,4,5-pentamethylcyclopentanecarbonyl)oxyhexane-1-sulfonic acid |
| SMILES | CC1C(C)C(C)C(C)(C(=O)OCCCCC(F)(F)C(F)(F)S(=O)(=O)O)C1C |
| InChI | InChI=1S/C17H28F4O5S/c1-10-11(2)13(4)15(5,12(10)3)14(22)26-9-7-6-8-16(18,19)17(20,21)27(23,24)25/h10-13H,6-9H2,1-5H3,(H,23,24,25) |
| InChIKey | SZZAINDTISDINM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|