C25H30F6O5S2 — CID 89393948
2-(1-adamantyl)propan-2-yl 2-[4-(1,1,2,2,3,3-hexafluorobutylsulfonyloxy)phenyl]sulfanylacetate (PubChem CID 89393948) has the molecular formula C25H30F6O5S2 and a molecular weight of 588.63 g/mol. Its IUPAC name is 2-(1-adamantyl)propan-2-yl 2-[4-(1,1,2,2,3,3-hexafluorobutylsulfonyloxy)phenyl]sulfanylacetate.
| Compound Name | 2-(1-adamantyl)propan-2-yl 2-[4-(1,1,2,2,3,3-hexafluorobutylsulfonyloxy)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 89393948 |
| Molecular Formula | C25H30F6O5S2 |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.14 |
| IUPAC Name | 2-(1-adamantyl)propan-2-yl 2-[4-(1,1,2,2,3,3-hexafluorobutylsulfonyloxy)phenyl]sulfanylacetate |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)Oc1ccc(SCC(=O)OC(C)(C)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H30F6O5S2/c1-21(2,23-11-15-8-16(12-23)10-17(9-15)13-23)35-20(32)14-37-19-6-4-18(5-7-19)36-38(33,34)25(30,31)24(28,29)22(3,26)27/h4-7,15-17H,8-14H2,1-3H3 |
| InChIKey | LNMZKDOBFSPBMW-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|