C21H42O3Si — CID 89394336
tert-butyl-[(3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-(2-methylpropoxy)octa-1,6-dien-4-yl]oxy-dimethylsilane (PubChem CID 89394336) has the molecular formula C21H42O3Si and a molecular weight of 370.65 g/mol. Its IUPAC name is tert-butyl-[(3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-(2-methylpropoxy)octa-1,6-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-(2-methylpropoxy)octa-1,6-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 89394336 |
| Molecular Formula | C21H42O3Si |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | tert-butyl-[(3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-(2-methylpropoxy)octa-1,6-dien-4-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(/C)COCC(C)C |
| InChI | InChI=1S/C21H42O3Si/c1-12-19(22-9)20(24-25(10,11)21(6,7)8)18(5)13-17(4)15-23-14-16(2)3/h12-13,16,18-20H,1,14-15H2,2-11H3/b17-13-/t18-,19+,20+/m1/s1 |
| InChIKey | CHEFBPDTXMUERQ-PYKSNXOHSA-N |
| XLogP | 5.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|