C17H23F3N2O3 — CID 89394432
(3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-[[5-(trifluoromethyl)pyrimidin-2-yl]methoxy]octa-1,6-dien-4-ol (PubChem CID 89394432) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is (3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-[[5-(trifluoromethyl)pyrimidin-2-yl]methoxy]octa-1,6-dien-4-ol.
| Compound Name | (3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-[[5-(trifluoromethyl)pyrimidin-2-yl]methoxy]octa-1,6-dien-4-ol |
|---|---|
| PubChem CID | 89394432 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-[[5-(trifluoromethyl)pyrimidin-2-yl]methoxy]octa-1,6-dien-4-ol |
| SMILES | C=C[C@H](OC)[C@@H](O)[C@H](C)/C=C(/C)COCc1ncc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H23F3N2O3/c1-5-14(24-4)16(23)12(3)6-11(2)9-25-10-15-21-7-13(8-22-15)17(18,19)20/h5-8,12,14,16,23H,1,9-10H2,2-4H3/b11-6-/t12-,14+,16+/m1/s1 |
| InChIKey | YMZYMYHBWCJTQS-RESSFXJCSA-N |
| XLogP | 3.16 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|