C18H25BN2O4 — CID 89394608
CID 89394608 (PubChem CID 89394608) has the molecular formula C18H25BN2O4 and a molecular weight of 344.22 g/mol.
| Compound Name | CID 89394608 |
|---|---|
| PubChem CID | 89394608 |
| Molecular Formula | C18H25BN2O4 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | — |
| SMILES | [B]OCC1(CN)CCCC2(CN(Cc3ccc(OC)cc3)C(=O)O2)C1 |
| InChI | InChI=1S/C18H25BN2O4/c1-23-15-5-3-14(4-6-15)9-21-12-18(25-16(21)22)8-2-7-17(10-18,11-20)13-24-19/h3-6H,2,7-13,20H2,1H3 |
| InChIKey | QTVTTXKFQKWXQJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|