C21H33N — CID 89394711
2,4-dimethyl-5-[3-[(5S)-5-methylcyclohex-2-en-1-yl]cyclohexa-1,3-dien-1-yl]hex-5-en-1-amine (PubChem CID 89394711) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is 2,4-dimethyl-5-[3-[(5S)-5-methylcyclohex-2-en-1-yl]cyclohexa-1,3-dien-1-yl]hex-5-en-1-amine.
| Compound Name | 2,4-dimethyl-5-[3-[(5S)-5-methylcyclohex-2-en-1-yl]cyclohexa-1,3-dien-1-yl]hex-5-en-1-amine |
|---|---|
| PubChem CID | 89394711 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 2,4-dimethyl-5-[3-[(5S)-5-methylcyclohex-2-en-1-yl]cyclohexa-1,3-dien-1-yl]hex-5-en-1-amine |
| SMILES | C=C(C1=CC(C2C=CC[C@H](C)C2)=CCC1)C(C)CC(C)CN |
| InChI | InChI=1S/C21H33N/c1-15-7-5-9-20(12-15)21-10-6-8-19(13-21)18(4)17(3)11-16(2)14-22/h5,9-10,13,15-17,20H,4,6-8,11-12,14,22H2,1-3H3/t15-,16?,17?,20?/m0/s1 |
| InChIKey | UINKTYFRUKTVJC-AKJOHPPZSA-N |
| XLogP | 5.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|