C13H19N — CID 89394716
5-methyl-2,4a,4b,5,6,8a,9,9a-octahydro-1H-carbazole (PubChem CID 89394716) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 5-methyl-2,4a,4b,5,6,8a,9,9a-octahydro-1H-carbazole.
| Compound Name | 5-methyl-2,4a,4b,5,6,8a,9,9a-octahydro-1H-carbazole |
|---|---|
| PubChem CID | 89394716 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 5-methyl-2,4a,4b,5,6,8a,9,9a-octahydro-1H-carbazole |
| SMILES | CC1CC=CC2NC3CCC=CC3C12 |
| InChI | InChI=1S/C13H19N/c1-9-5-4-8-12-13(9)10-6-2-3-7-11(10)14-12/h2,4,6,8-14H,3,5,7H2,1H3 |
| InChIKey | GYEIPUFWWSWXGT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|