C20H27NS — CID 89394756
5-amino-6-(6-methylcyclohexa-1,3-dien-1-yl)-2-(1-methylcyclohex-3-en-1-yl)cyclohexa-1,5-diene-1-thiol (PubChem CID 89394756) has the molecular formula C20H27NS and a molecular weight of 313.51 g/mol. Its IUPAC name is 5-amino-6-(6-methylcyclohexa-1,3-dien-1-yl)-2-(1-methylcyclohex-3-en-1-yl)cyclohexa-1,5-diene-1-thiol.
| Compound Name | 5-amino-6-(6-methylcyclohexa-1,3-dien-1-yl)-2-(1-methylcyclohex-3-en-1-yl)cyclohexa-1,5-diene-1-thiol |
|---|---|
| PubChem CID | 89394756 |
| Molecular Formula | C20H27NS |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 5-amino-6-(6-methylcyclohexa-1,3-dien-1-yl)-2-(1-methylcyclohex-3-en-1-yl)cyclohexa-1,5-diene-1-thiol |
| SMILES | CC1CC=CC=C1C1=C(N)CCC(C2(C)CC=CCC2)=C1S |
| InChI | InChI=1S/C20H27NS/c1-14-8-4-5-9-15(14)18-17(21)11-10-16(19(18)22)20(2)12-6-3-7-13-20/h3-6,9,14,22H,7-8,10-13,21H2,1-2H3 |
| InChIKey | SOKVRWBKMBYXOS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|