C19H25NS — CID 89394818
(5R)-2-(4-amino-3-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-yl)-5-methylcyclohexa-1,3-diene-1-thiol (PubChem CID 89394818) has the molecular formula C19H25NS and a molecular weight of 299.48 g/mol. Its IUPAC name is (5R)-2-(4-amino-3-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-yl)-5-methylcyclohexa-1,3-diene-1-thiol.
| Compound Name | (5R)-2-(4-amino-3-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-yl)-5-methylcyclohexa-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 89394818 |
| Molecular Formula | C19H25NS |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (5R)-2-(4-amino-3-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-yl)-5-methylcyclohexa-1,3-diene-1-thiol |
| SMILES | C[C@H]1C=CC(C2=CC(C3C=CCCC3)=C(N)CC2)=C(S)C1 |
| InChI | InChI=1S/C19H25NS/c1-13-7-9-16(19(21)11-13)15-8-10-18(20)17(12-15)14-5-3-2-4-6-14/h3,5,7,9,12-14,21H,2,4,6,8,10-11,20H2,1H3/t13-,14?/m0/s1 |
| InChIKey | UXLCGAFJAXAPJB-LSLKUGRBSA-N |
| XLogP | 5.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|