C23H30Cl2FN5O2 — CID 89394902
N'-[(2Z)-4-(3,4-dichloroanilino)-3-methyl-1-(4-morpholin-4-ylpiperidin-1-yl)-1-oxopenta-2,4-dien-2-yl]-2-fluoroethanimidamide (PubChem CID 89394902) has the molecular formula C23H30Cl2FN5O2 and a molecular weight of 498.43 g/mol. Its IUPAC name is N'-[(2Z)-4-(3,4-dichloroanilino)-3-methyl-1-(4-morpholin-4-ylpiperidin-1-yl)-1-oxopenta-2,4-dien-2-yl]-2-fluoroethanimidamide.
| Compound Name | N'-[(2Z)-4-(3,4-dichloroanilino)-3-methyl-1-(4-morpholin-4-ylpiperidin-1-yl)-1-oxopenta-2,4-dien-2-yl]-2-fluoroethanimidamide |
|---|---|
| PubChem CID | 89394902 |
| Molecular Formula | C23H30Cl2FN5O2 |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N'-[(2Z)-4-(3,4-dichloroanilino)-3-methyl-1-(4-morpholin-4-ylpiperidin-1-yl)-1-oxopenta-2,4-dien-2-yl]-2-fluoroethanimidamide |
| SMILES | C=C(Nc1ccc(Cl)c(Cl)c1)/C(C)=C(\N=C(\N)CF)C(=O)N1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C23H30Cl2FN5O2/c1-15(16(2)28-17-3-4-19(24)20(25)13-17)22(29-21(27)14-26)23(32)31-7-5-18(6-8-31)30-9-11-33-12-10-30/h3-4,13,18,28H,2,5-12,14H2,1H3,(H2,27,29)/b22-15- |
| InChIKey | UQSURCCETPKKHN-JCMHNJIXSA-N |
| XLogP | 3.84 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|