C28H35F6N5O2 — CID 89394929
2,2,2-trifluoro-N'-[(2Z)-3-methyl-1-[4-(oxan-4-ylamino)piperidin-1-yl]-1-oxo-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dien-2-yl]ethanimidamide (PubChem CID 89394929) has the molecular formula C28H35F6N5O2 and a molecular weight of 587.61 g/mol. Its IUPAC name is 2,2,2-trifluoro-N'-[(2Z)-3-methyl-1-[4-(oxan-4-ylamino)piperidin-1-yl]-1-oxo-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dien-2-yl]ethanimidamide.
| Compound Name | 2,2,2-trifluoro-N'-[(2Z)-3-methyl-1-[4-(oxan-4-ylamino)piperidin-1-yl]-1-oxo-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 89394929 |
| Molecular Formula | C28H35F6N5O2 |
| Molecular Weight | 587.61 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | 2,2,2-trifluoro-N'-[(2Z)-3-methyl-1-[4-(oxan-4-ylamino)piperidin-1-yl]-1-oxo-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dien-2-yl]ethanimidamide |
| SMILES | C=C(/C(C)=C(\N=C(\N)C(F)(F)F)C(=O)N1CCC(NC2CCOCC2)CC1)N1CCc2ccc(C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C28H35F6N5O2/c1-17(18(2)39-10-5-19-3-4-21(27(29,30)31)15-20(19)16-39)24(37-26(35)28(32,33)34)25(40)38-11-6-22(7-12-38)36-23-8-13-41-14-9-23/h3-4,15,22-23,36H,2,5-14,16H2,1H3,(H2,35,37)/b24-17- |
| InChIKey | VRNXZAUPJJPJET-ULJHMMPZSA-N |
| XLogP | 4.53 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|