C13H17N — CID 89395387
2-methyl-2,3,4,5,6,9-hexahydro-1H-carbazole (PubChem CID 89395387) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 2-methyl-2,3,4,5,6,9-hexahydro-1H-carbazole.
| Compound Name | 2-methyl-2,3,4,5,6,9-hexahydro-1H-carbazole |
|---|---|
| PubChem CID | 89395387 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-methyl-2,3,4,5,6,9-hexahydro-1H-carbazole |
| SMILES | CC1CCc2c([nH]c3c2CCC=C3)C1 |
| InChI | InChI=1S/C13H17N/c1-9-6-7-11-10-4-2-3-5-12(10)14-13(11)8-9/h3,5,9,14H,2,4,6-8H2,1H3 |
| InChIKey | FWIUZMJCIIIYIT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |