C29H34N6O4 — CID 89395445
2-[3-(4-cyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-N-[(1R,2R)-2-[[1-(4-nitrophenyl)piperidin-3-yl]amino]cyclohexyl]acetamide (PubChem CID 89395445) has the molecular formula C29H34N6O4 and a molecular weight of 530.63 g/mol. Its IUPAC name is 2-[3-(4-cyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-N-[(1R,2R)-2-[[1-(4-nitrophenyl)piperidin-3-yl]amino]cyclohexyl]acetamide.
| Compound Name | 2-[3-(4-cyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-N-[(1R,2R)-2-[[1-(4-nitrophenyl)piperidin-3-yl]amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 89395445 |
| Molecular Formula | C29H34N6O4 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 2-[3-(4-cyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-N-[(1R,2R)-2-[[1-(4-nitrophenyl)piperidin-3-yl]amino]cyclohexyl]acetamide |
| SMILES | N#Cc1ccc(C2=NOC(CC(=O)N[C@@H]3CCCC[C@H]3NC3CCCN(c4ccc([N+](=O)[O-])cc4)C3)C2)cc1 |
| InChI | InChI=1S/C29H34N6O4/c30-18-20-7-9-21(10-8-20)28-16-25(39-33-28)17-29(36)32-27-6-2-1-5-26(27)31-22-4-3-15-34(19-22)23-11-13-24(14-12-23)35(37)38/h7-14,22,25-27,31H,1-6,15-17,19H2,(H,32,36)/t22?,25?,26-,27-/m1/s1 |
| InChIKey | CQLXEGVCXVMBQQ-KQTARHOWSA-N |
| XLogP | 4.04 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|