C13H19N — CID 89395447
4a-methyl-1,2,4b,5,6,8a,9,9a-octahydrocarbazole (PubChem CID 89395447) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 4a-methyl-1,2,4b,5,6,8a,9,9a-octahydrocarbazole.
| Compound Name | 4a-methyl-1,2,4b,5,6,8a,9,9a-octahydrocarbazole |
|---|---|
| PubChem CID | 89395447 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 4a-methyl-1,2,4b,5,6,8a,9,9a-octahydrocarbazole |
| SMILES | CC12C=CCCC1NC1C=CCCC12 |
| InChI | InChI=1S/C13H19N/c1-13-9-5-4-8-12(13)14-11-7-3-2-6-10(11)13/h3,5,7,9-12,14H,2,4,6,8H2,1H3 |
| InChIKey | KMPQMMPMCPMZNO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|