C26H43N3 — CID 89395476
3-[[(3S)-2-cyclohexyl-3-[(6-methylcyclohexa-2,4-dien-1-yl)methyl]aziridin-1-yl]-(methylamino)methyl]-4,6-dimethylcyclohex-2-en-1-amine (PubChem CID 89395476) has the molecular formula C26H43N3 and a molecular weight of 397.65 g/mol. Its IUPAC name is 3-[[(3S)-2-cyclohexyl-3-[(6-methylcyclohexa-2,4-dien-1-yl)methyl]aziridin-1-yl]-(methylamino)methyl]-4,6-dimethylcyclohex-2-en-1-amine.
| Compound Name | 3-[[(3S)-2-cyclohexyl-3-[(6-methylcyclohexa-2,4-dien-1-yl)methyl]aziridin-1-yl]-(methylamino)methyl]-4,6-dimethylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 89395476 |
| Molecular Formula | C26H43N3 |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 397.35 |
| IUPAC Name | 3-[[(3S)-2-cyclohexyl-3-[(6-methylcyclohexa-2,4-dien-1-yl)methyl]aziridin-1-yl]-(methylamino)methyl]-4,6-dimethylcyclohex-2-en-1-amine |
| SMILES | CNC(C1=CC(N)C(C)CC1C)N1C(C2CCCCC2)[C@@H]1CC1C=CC=CC1C |
| InChI | InChI=1S/C26H43N3/c1-17-10-8-9-13-21(17)15-24-25(20-11-6-5-7-12-20)29(24)26(28-4)22-16-23(27)19(3)14-18(22)2/h8-10,13,16-21,23-26,28H,5-7,11-12,14-15,27H2,1-4H3/t17?,18?,19?,21?,23?,24-,25?,26?,29?/m0/s1 |
| InChIKey | RNAIOMZWEVLKFU-XCPSFVLQSA-N |
| XLogP | 4.86 |
| TPSA | 41.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|