About 6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine
6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine (PubChem CID 89395478) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is 6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 89395478 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine |
| SMILES | NC1C=CC=CC1C1=CCCCC1 |
| InChI | InChI=1S/C12H17N/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4-6,8-9,11-12H,1-3,7,13H2 |
| InChIKey | RKEGGXFLBVPRCG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of 6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine (CID 89395478) is 6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine is NC1C=CC=CC1C1=CCCCC1.
What is the InChIKey of 6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine?
The InChIKey is RKEGGXFLBVPRCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4-6,8-9,11-12H,1-3,7,13H2.
What are the key properties of 6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine?
6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine has a molecular weight of 175.28 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(cyclohexen-1-yl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 89395478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).