C24H24IN7O — CID 89395487
[5-[[4-[4-(iodomethyl)-2-pyridinyl]pyrimidin-2-yl]amino]-1H-indol-2-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 89395487) has the molecular formula C24H24IN7O and a molecular weight of 553.41 g/mol. Its IUPAC name is [5-[[4-[4-(iodomethyl)-2-pyridinyl]pyrimidin-2-yl]amino]-1H-indol-2-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [5-[[4-[4-(iodomethyl)-2-pyridinyl]pyrimidin-2-yl]amino]-1H-indol-2-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 89395487 |
| Molecular Formula | C24H24IN7O |
| Molecular Weight | 553.41 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | [5-[[4-[4-(iodomethyl)-2-pyridinyl]pyrimidin-2-yl]amino]-1H-indol-2-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cc3cc(Nc4nccc(-c5cc(CI)ccn5)n4)ccc3[nH]2)CC1 |
| InChI | InChI=1S/C24H24IN7O/c1-31-8-10-32(11-9-31)23(33)22-14-17-13-18(2-3-19(17)29-22)28-24-27-7-5-20(30-24)21-12-16(15-25)4-6-26-21/h2-7,12-14,29H,8-11,15H2,1H3,(H,27,28,30) |
| InChIKey | KAENJVMFOWTWQW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|