C19H19ClN4O2 — CID 89395489
benzyl 2-(8-chloroimidazo[1,5-a]pyrazin-3-yl)piperidine-1-carboxylate (PubChem CID 89395489) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is benzyl 2-(8-chloroimidazo[1,5-a]pyrazin-3-yl)piperidine-1-carboxylate.
| Compound Name | benzyl 2-(8-chloroimidazo[1,5-a]pyrazin-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89395489 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | benzyl 2-(8-chloroimidazo[1,5-a]pyrazin-3-yl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCCC1c1ncc2c(Cl)nccn12 |
| InChI | InChI=1S/C19H19ClN4O2/c20-17-16-12-22-18(23(16)11-9-21-17)15-8-4-5-10-24(15)19(25)26-13-14-6-2-1-3-7-14/h1-3,6-7,9,11-12,15H,4-5,8,10,13H2 |
| InChIKey | JVXMGBYCKQHDIK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |