C24H17F3IN5OS — CID 89395504
8-(iodomethyl)-3-[(1S)-1-([1,3]thiazolo[5,4-d]pyrimidin-7-ylamino)ethyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one (PubChem CID 89395504) has the molecular formula C24H17F3IN5OS and a molecular weight of 607.40 g/mol. Its IUPAC name is 8-(iodomethyl)-3-[(1S)-1-([1,3]thiazolo[5,4-d]pyrimidin-7-ylamino)ethyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one.
| Compound Name | 8-(iodomethyl)-3-[(1S)-1-([1,3]thiazolo[5,4-d]pyrimidin-7-ylamino)ethyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 89395504 |
| Molecular Formula | C24H17F3IN5OS |
| Molecular Weight | 607.40 g/mol |
| Exact Mass | 607.02 |
| IUPAC Name | 8-(iodomethyl)-3-[(1S)-1-([1,3]thiazolo[5,4-d]pyrimidin-7-ylamino)ethyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
| SMILES | C[C@H](Nc1ncnc2scnc12)c1cc2cccc(CI)c2c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H17F3IN5OS/c1-13(32-21-20-22(30-11-29-21)35-12-31-20)18-8-14-4-2-5-15(10-28)19(14)23(34)33(18)17-7-3-6-16(9-17)24(25,26)27/h2-9,11-13H,10H2,1H3,(H,29,30,32)/t13-/m0/s1 |
| InChIKey | XYSIKZJPEKFMPI-ZDUSSCGKSA-N |
| XLogP | 6.52 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.40 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|