C13H22N2O2 — CID 89395564
(2E,4E)-N-(2-hydroxyethyl)-2-methyl-5-piperidin-1-ylpenta-2,4-dienamide (PubChem CID 89395564) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2E,4E)-N-(2-hydroxyethyl)-2-methyl-5-piperidin-1-ylpenta-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-hydroxyethyl)-2-methyl-5-piperidin-1-ylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 89395564 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (2E,4E)-N-(2-hydroxyethyl)-2-methyl-5-piperidin-1-ylpenta-2,4-dienamide |
| SMILES | C/C(=C\C=C\N1CCCCC1)C(=O)NCCO |
| InChI | InChI=1S/C13H22N2O2/c1-12(13(17)14-7-11-16)6-5-10-15-8-3-2-4-9-15/h5-6,10,16H,2-4,7-9,11H2,1H3,(H,14,17)/b10-5+,12-6+ |
| InChIKey | UMPGVTMLWWTDIH-NPPOFJFTSA-N |
| XLogP | 1.04 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|