C23H43NO4Si — CID 89395615
N-but-3-enyl-2-[(2Z,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethylocta-2,7-dienoxy]acetamide (PubChem CID 89395615) has the molecular formula C23H43NO4Si and a molecular weight of 425.69 g/mol. Its IUPAC name is N-but-3-enyl-2-[(2Z,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethylocta-2,7-dienoxy]acetamide.
| Compound Name | N-but-3-enyl-2-[(2Z,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethylocta-2,7-dienoxy]acetamide |
|---|---|
| PubChem CID | 89395615 |
| Molecular Formula | C23H43NO4Si |
| Molecular Weight | 425.69 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | N-but-3-enyl-2-[(2Z,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethylocta-2,7-dienoxy]acetamide |
| SMILES | C=CCCNC(=O)COC/C(C)=C\[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=C)OC |
| InChI | InChI=1S/C23H43NO4Si/c1-11-13-14-24-21(25)17-27-16-18(3)15-19(4)22(20(12-2)26-8)28-29(9,10)23(5,6)7/h11-12,15,19-20,22H,1-2,13-14,16-17H2,3-10H3,(H,24,25)/b18-15-/t19-,20+,22+/m1/s1 |
| InChIKey | ZRYPIYGQSKHPJV-AZRNUABQSA-N |
| XLogP | 4.87 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|