About 4-butyl-4-ethyloxane
4-butyl-4-ethyloxane (PubChem CID 89395620) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is 4-butyl-4-ethyloxane.
Molecular Properties
| Compound Name | 4-butyl-4-ethyloxane |
| PubChem CID | 89395620 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 4-butyl-4-ethyloxane |
| SMILES | CCCCC1(CC)CCOCC1 |
| InChI | InChI=1S/C11H22O/c1-3-5-6-11(4-2)7-9-12-10-8-11/h3-10H2,1-2H3 |
| InChIKey | ZKPHOLXSQZWUIC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butyl-4-ethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-4-ethyloxane?
The IUPAC name of 4-butyl-4-ethyloxane (CID 89395620) is 4-butyl-4-ethyloxane.
What is the SMILES notation for 4-butyl-4-ethyloxane?
The canonical SMILES for 4-butyl-4-ethyloxane is CCCCC1(CC)CCOCC1.
What is the InChIKey of 4-butyl-4-ethyloxane?
The InChIKey is ZKPHOLXSQZWUIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O/c1-3-5-6-11(4-2)7-9-12-10-8-11/h3-10H2,1-2H3.
What are the key properties of 4-butyl-4-ethyloxane?
4-butyl-4-ethyloxane has a molecular weight of 170.30 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-4-ethyloxane is sourced from PubChem (CID 89395620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).