About N'-(cyanomethyl)-N'-methylpropanediamide
N'-(cyanomethyl)-N'-methylpropanediamide (PubChem CID 89395698) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is N'-(cyanomethyl)-N'-methylpropanediamide.
Molecular Properties
| Compound Name | N'-(cyanomethyl)-N'-methylpropanediamide |
| PubChem CID | 89395698 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N'-(cyanomethyl)-N'-methylpropanediamide |
| SMILES | CN(CC#N)C(=O)CC(N)=O |
| InChI | InChI=1S/C6H9N3O2/c1-9(3-2-7)6(11)4-5(8)10/h3-4H2,1H3,(H2,8,10) |
| InChIKey | CIPJACXPIGLPRZ-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N'-(cyanomethyl)-N'-methylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(cyanomethyl)-N'-methylpropanediamide?
The IUPAC name of N'-(cyanomethyl)-N'-methylpropanediamide (CID 89395698) is N'-(cyanomethyl)-N'-methylpropanediamide.
What is the SMILES notation for N'-(cyanomethyl)-N'-methylpropanediamide?
The canonical SMILES for N'-(cyanomethyl)-N'-methylpropanediamide is CN(CC#N)C(=O)CC(N)=O.
What is the InChIKey of N'-(cyanomethyl)-N'-methylpropanediamide?
The InChIKey is CIPJACXPIGLPRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c1-9(3-2-7)6(11)4-5(8)10/h3-4H2,1H3,(H2,8,10).
What are the key properties of N'-(cyanomethyl)-N'-methylpropanediamide?
N'-(cyanomethyl)-N'-methylpropanediamide has a molecular weight of 155.16 g/mol, XLogP of -1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(cyanomethyl)-N'-methylpropanediamide is sourced from PubChem (CID 89395698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).