C37H47N4Na2O8P — CID 89395835
disodium;[(2S,3S,5S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-5-[[(2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoyl]amino]-1,3-diphenylhexan-3-yl] phosphate (PubChem CID 89395835) has the molecular formula C37H47N4Na2O8P and a molecular weight of 752.76 g/mol. Its IUPAC name is disodium;[(2S,3S,5S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-5-[[(2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoyl]amino]-1,3-diphenylhexan-3-yl] phosphate.
| Compound Name | disodium;[(2S,3S,5S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-5-[[(2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoyl]amino]-1,3-diphenylhexan-3-yl] phosphate |
|---|---|
| PubChem CID | 89395835 |
| Molecular Formula | C37H47N4Na2O8P |
| Molecular Weight | 752.76 g/mol |
| Exact Mass | 752.29 |
| IUPAC Name | disodium;[(2S,3S,5S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-5-[[(2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoyl]amino]-1,3-diphenylhexan-3-yl] phosphate |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@](C[C@H](C)NC(=O)[C@H](C(C)C)N1CCCNC1=O)(OP(=O)([O-])[O-])c1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C37H49N4O8P.2Na/c1-25(2)33(41-21-13-20-38-36(41)44)35(43)39-28(5)23-37(49-50(45,46)47,30-18-10-7-11-19-30)31(22-29-16-8-6-9-17-29)40-32(42)24-48-34-26(3)14-12-15-27(34)4;;/h6-12,14-19,25,28,31,33H,13,20-24H2,1-5H3,(H,38,44)(H,39,43)(H,40,42)(H2,45,46,47);;/q;2*+1/p-2/t28-,31-,33-,37-;;/m0../s1 |
| InChIKey | LMQNBRQCYIPVBQ-SPWZUXNFSA-L |
| XLogP | -2.51 |
| TPSA | 172.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.76 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|