C6H11N5 — CID 89395927
5-N-ethyl-5-N-methyl-1,2,4-triazine-3,5-diamine (PubChem CID 89395927) has the molecular formula C6H11N5 and a molecular weight of 153.19 g/mol. Its IUPAC name is 5-N-ethyl-5-N-methyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-ethyl-5-N-methyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 89395927 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 5-N-ethyl-5-N-methyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCN(C)c1cnnc(N)n1 |
| InChI | InChI=1S/C6H11N5/c1-3-11(2)5-4-8-10-6(7)9-5/h4H,3H2,1-2H3,(H2,7,9,10) |
| InChIKey | MMSKLKLIZBLUAS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |