C80H64Br4N4 — CID 89396132
5,15-bis[3,5-bis(2,4,6-trimethylphenyl)phenyl]-10,20-bis(2,6-dibromophenyl)porphyrin (PubChem CID 89396132) has the molecular formula C80H64Br4N4 and a molecular weight of 1401.04 g/mol. Its IUPAC name is 5,15-bis[3,5-bis(2,4,6-trimethylphenyl)phenyl]-10,20-bis(2,6-dibromophenyl)porphyrin.
| Compound Name | 5,15-bis[3,5-bis(2,4,6-trimethylphenyl)phenyl]-10,20-bis(2,6-dibromophenyl)porphyrin |
|---|---|
| PubChem CID | 89396132 |
| Molecular Formula | C80H64Br4N4 |
| Molecular Weight | 1401.04 g/mol |
| Exact Mass | 1396.19 |
| IUPAC Name | 5,15-bis[3,5-bis(2,4,6-trimethylphenyl)phenyl]-10,20-bis(2,6-dibromophenyl)porphyrin |
| SMILES | Cc1cc(C)c(-c2cc(/C3=C4\C=CC(=N4)/C(c4c(Br)cccc4Br)=C4/C=CC(=N4)/C(c4cc(-c5c(C)cc(C)cc5C)cc(-c5c(C)cc(C)cc5C)c4)=C4/C=CC(=N4)/C(c4c(Br)cccc4Br)=C4/C=CC3=N4)cc(-c3c(C)cc(C)cc3C)c2)c(C)c1 |
| InChI | InChI=1S/C80H64Br4N4/c1-41-27-45(5)71(46(6)28-41)53-35-54(72-47(7)29-42(2)30-48(72)8)38-57(37-53)75-63-19-23-67(85-63)79(77-59(81)15-13-16-60(77)82)69-25-21-65(87-69)76(66-22-26-70(88-66)80(68-24-20-64(75)86-68)78-61(83)17-14-18-62(78)84)58-39-55(73-49(9)31-43(3)32-50(73)10)36-56(40-58)74-51(11)33-44(4)34-52(74)12/h13-40H,1-12H3/b75-63-,75-64-,76-65-,76-66-,79-67+,79-69+,80-68+,80-70+ |
| InChIKey | UCRVYEQBHHRDFL-ASCWPQLESA-N |
| XLogP | 23.11 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1401.04 |
| LogP ≤ 5 | 23.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |